C16H28N2O5S — CID 75428768
1-(1-butylsulfonylpiperidine-4-carbonyl)piperidine-2-carboxylic acid (PubChem CID 75428768) has the molecular formula C16H28N2O5S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-(1-butylsulfonylpiperidine-4-carbonyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(1-butylsulfonylpiperidine-4-carbonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 75428768 |
| Molecular Formula | C16H28N2O5S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-(1-butylsulfonylpiperidine-4-carbonyl)piperidine-2-carboxylic acid |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)N2CCCCC2C(=O)O)CC1 |
| InChI | InChI=1S/C16H28N2O5S/c1-2-3-12-24(22,23)17-10-7-13(8-11-17)15(19)18-9-5-4-6-14(18)16(20)21/h13-14H,2-12H2,1H3,(H,20,21) |
| InChIKey | AZPJAJMBUGTUQA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |