C17H34ClN3O3S — CID 119594012
[3-(1-aminoethyl)piperidin-1-yl]-(1-butylsulfonylpiperidin-4-yl)methanone;hydrochloride (PubChem CID 119594012) has the molecular formula C17H34ClN3O3S and a molecular weight of 396.00 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-(1-butylsulfonylpiperidin-4-yl)methanone;hydrochloride.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-(1-butylsulfonylpiperidin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119594012 |
| Molecular Formula | C17H34ClN3O3S |
| Molecular Weight | 396.00 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-(1-butylsulfonylpiperidin-4-yl)methanone;hydrochloride |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)N2CCCC(C(C)N)C2)CC1.Cl |
| InChI | InChI=1S/C17H33N3O3S.ClH/c1-3-4-12-24(22,23)20-10-7-15(8-11-20)17(21)19-9-5-6-16(13-19)14(2)18;/h14-16H,3-13,18H2,1-2H3;1H |
| InChIKey | AILVOCQRTNTQCS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.00 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |