C19H31N3O2 — CID 60611198
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone (PubChem CID 60611198) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 60611198 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-[1-(pyrrolidine-1-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(N1CCCC1)N1CCC(C(=O)N2CCC3CCCCC32)CC1 |
| InChI | InChI=1S/C19H31N3O2/c23-18(22-14-9-15-5-1-2-6-17(15)22)16-7-12-21(13-8-16)19(24)20-10-3-4-11-20/h15-17H,1-14H2 |
| InChIKey | DYRAXWDTULXHLX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |