C16H26N2O3 — CID 81120757
(3R)-1-(2-cyclopentylpyrrolidine-1-carbonyl)piperidine-3-carboxylic acid (PubChem CID 81120757) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3R)-1-(2-cyclopentylpyrrolidine-1-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(2-cyclopentylpyrrolidine-1-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81120757 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (3R)-1-(2-cyclopentylpyrrolidine-1-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)N2CCCC2C2CCCC2)C1 |
| InChI | InChI=1S/C16H26N2O3/c19-15(20)13-7-3-9-17(11-13)16(21)18-10-4-8-14(18)12-5-1-2-6-12/h12-14H,1-11H2,(H,19,20)/t13-,14?/m1/s1 |
| InChIKey | BULBKEAGDRGCPQ-KWCCSABGSA-N |
| XLogP | 2.56 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |