C14H21N3O4 — CID 103197380
(3R)-1-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)piperidine-3-carboxylic acid (PubChem CID 103197380) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is (3R)-1-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 103197380 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (3R)-1-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C1NCC2C1CCCN2C(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H21N3O4/c18-12-10-4-2-6-17(11(10)7-15-12)14(21)16-5-1-3-9(8-16)13(19)20/h9-11H,1-8H2,(H,15,18)(H,19,20)/t9-,10?,11?/m1/s1 |
| InChIKey | SEBSVUVHHTZUQY-KPPDAEKUSA-N |
| XLogP | 0.11 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |