C13H20N2O3 — CID 112738873
cyclopentyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate (PubChem CID 112738873) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is cyclopentyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate.
| Compound Name | cyclopentyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 112738873 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | cyclopentyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate |
| SMILES | O=C1NCC2C1CCCN2C(=O)OC1CCCC1 |
| InChI | InChI=1S/C13H20N2O3/c16-12-10-6-3-7-15(11(10)8-14-12)13(17)18-9-4-1-2-5-9/h9-11H,1-8H2,(H,14,16) |
| InChIKey | MDXDWLGJHMQTRG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |