C11H16ClN3O3 — CID 103197422
N-(3-chloropropanoyl)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide (PubChem CID 103197422) has the molecular formula C11H16ClN3O3 and a molecular weight of 273.72 g/mol. Its IUPAC name is N-(3-chloropropanoyl)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide.
| Compound Name | N-(3-chloropropanoyl)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 103197422 |
| Molecular Formula | C11H16ClN3O3 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(3-chloropropanoyl)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
| SMILES | O=C(CCCl)NC(=O)N1CCCC2C(=O)NCC21 |
| InChI | InChI=1S/C11H16ClN3O3/c12-4-3-9(16)14-11(18)15-5-1-2-7-8(15)6-13-10(7)17/h7-8H,1-6H2,(H,13,17)(H,14,16,18) |
| InChIKey | GMTAOVIFOVOSGG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|