C9H13ClN2O3 — CID 164660381
chloromethyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate (PubChem CID 164660381) has the molecular formula C9H13ClN2O3 and a molecular weight of 232.67 g/mol. Its IUPAC name is chloromethyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate.
| Compound Name | chloromethyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164660381 |
| Molecular Formula | C9H13ClN2O3 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | chloromethyl 5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxylate |
| SMILES | O=C1NCC2C1CCCN2C(=O)OCCl |
| InChI | InChI=1S/C9H13ClN2O3/c10-5-15-9(14)12-3-1-2-6-7(12)4-11-8(6)13/h6-7H,1-5H2,(H,11,13) |
| InChIKey | HXZYQZVWHSIPOK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|