C12H19N3O4 — CID 103197364
(2S)-2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)amino]butanoic acid (PubChem CID 103197364) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 103197364 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2S)-2-[(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl)amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)N1CCCC2C(=O)NCC21)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-2-8(11(17)18)14-12(19)15-5-3-4-7-9(15)6-13-10(7)16/h7-9H,2-6H2,1H3,(H,13,16)(H,14,19)(H,17,18)/t7?,8-,9?/m0/s1 |
| InChIKey | PKTADONEJQYFQV-MGURRDGZSA-N |
| XLogP | -0.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |