C9H14ClNO — CID 93494912
(3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl chloride (PubChem CID 93494912) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl chloride.
| Compound Name | (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl chloride |
|---|---|
| PubChem CID | 93494912 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C9H14ClNO/c10-9(12)11-6-5-7-3-1-2-4-8(7)11/h7-8H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | LEWYUUYUTMWBIB-HTQZYQBOSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|