C21H29BrN2O3S — CID 55905635
[1-(4-bromophenyl)sulfonylpiperidin-3-yl]-(2-cyclopentylpyrrolidin-1-yl)methanone (PubChem CID 55905635) has the molecular formula C21H29BrN2O3S and a molecular weight of 469.45 g/mol. Its IUPAC name is [1-(4-bromophenyl)sulfonylpiperidin-3-yl]-(2-cyclopentylpyrrolidin-1-yl)methanone.
| Compound Name | [1-(4-bromophenyl)sulfonylpiperidin-3-yl]-(2-cyclopentylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 55905635 |
| Molecular Formula | C21H29BrN2O3S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [1-(4-bromophenyl)sulfonylpiperidin-3-yl]-(2-cyclopentylpyrrolidin-1-yl)methanone |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1)N1CCCC1C1CCCC1 |
| InChI | InChI=1S/C21H29BrN2O3S/c22-18-9-11-19(12-10-18)28(26,27)23-13-3-7-17(15-23)21(25)24-14-4-8-20(24)16-5-1-2-6-16/h9-12,16-17,20H,1-8,13-15H2 |
| InChIKey | SJXJPEVQRLAMBT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |