C18H18BrIN2O3S — CID 126380948
(3R)-1-(4-bromophenyl)sulfonyl-N-(4-iodophenyl)piperidine-3-carboxamide (PubChem CID 126380948) has the molecular formula C18H18BrIN2O3S and a molecular weight of 549.23 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)sulfonyl-N-(4-iodophenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-bromophenyl)sulfonyl-N-(4-iodophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126380948 |
| Molecular Formula | C18H18BrIN2O3S |
| Molecular Weight | 549.23 g/mol |
| Exact Mass | 547.93 |
| IUPAC Name | (3R)-1-(4-bromophenyl)sulfonyl-N-(4-iodophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)[C@@H]1CCCN(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H18BrIN2O3S/c19-14-3-9-17(10-4-14)26(24,25)22-11-1-2-13(12-22)18(23)21-16-7-5-15(20)6-8-16/h3-10,13H,1-2,11-12H2,(H,21,23)/t13-/m1/s1 |
| InChIKey | XPFFDSXQUDABTD-CYBMUJFWSA-N |
| XLogP | 4.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|