C20H21BrN2O5S — CID 2234292
methyl 4-[[(3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate (PubChem CID 2234292) has the molecular formula C20H21BrN2O5S and a molecular weight of 481.37 g/mol. Its IUPAC name is methyl 4-[[(3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[(3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 2234292 |
| Molecular Formula | C20H21BrN2O5S |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | methyl 4-[[(3R)-1-(4-bromophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C20H21BrN2O5S/c1-28-20(25)14-4-8-17(9-5-14)22-19(24)15-3-2-12-23(13-15)29(26,27)18-10-6-16(21)7-11-18/h4-11,15H,2-3,12-13H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | ZJPMSPHNBJXFGY-OAHLLOKOSA-N |
| XLogP | 3.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |