C21H34N2O2S — CID 55922029
1-[[1-[3-(benzenesulfonyl)propyl]piperidin-4-yl]methyl]azepane (PubChem CID 55922029) has the molecular formula C21H34N2O2S and a molecular weight of 378.58 g/mol. Its IUPAC name is 1-[[1-[3-(benzenesulfonyl)propyl]piperidin-4-yl]methyl]azepane.
| Compound Name | 1-[[1-[3-(benzenesulfonyl)propyl]piperidin-4-yl]methyl]azepane |
|---|---|
| PubChem CID | 55922029 |
| Molecular Formula | C21H34N2O2S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-[[1-[3-(benzenesulfonyl)propyl]piperidin-4-yl]methyl]azepane |
| SMILES | O=S(=O)(CCCN1CCC(CN2CCCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H34N2O2S/c24-26(25,21-9-4-3-5-10-21)18-8-15-22-16-11-20(12-17-22)19-23-13-6-1-2-7-14-23/h3-5,9-10,20H,1-2,6-8,11-19H2 |
| InChIKey | DCKKGWHUNUISGF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |