C19H28N2O6S — CID 70360543
N-[2-(benzenesulfonyl)ethyl]-2-piperidin-1-ylethanamine;(Z)-but-2-enedioic acid (PubChem CID 70360543) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-2-piperidin-1-ylethanamine;(Z)-but-2-enedioic acid.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-2-piperidin-1-ylethanamine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70360543 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-2-piperidin-1-ylethanamine;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.O=S(=O)(CCNCCN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O2S.C4H4O4/c18-20(19,15-7-3-1-4-8-15)14-10-16-9-13-17-11-5-2-6-12-17;5-3(6)1-2-4(7)8/h1,3-4,7-8,16H,2,5-6,9-14H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ZIYSQWHDYWHBTH-BTJKTKAUSA-N |
| XLogP | 1.25 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|