C21H31FN2O3S — CID 51127471
N-cyclohexyl-1-[3-(4-fluorophenyl)sulfonylpropyl]piperidine-4-carboxamide (PubChem CID 51127471) has the molecular formula C21H31FN2O3S and a molecular weight of 410.56 g/mol. Its IUPAC name is N-cyclohexyl-1-[3-(4-fluorophenyl)sulfonylpropyl]piperidine-4-carboxamide.
| Compound Name | N-cyclohexyl-1-[3-(4-fluorophenyl)sulfonylpropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51127471 |
| Molecular Formula | C21H31FN2O3S |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-cyclohexyl-1-[3-(4-fluorophenyl)sulfonylpropyl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCN(CCCS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H31FN2O3S/c22-18-7-9-20(10-8-18)28(26,27)16-4-13-24-14-11-17(12-15-24)21(25)23-19-5-2-1-3-6-19/h7-10,17,19H,1-6,11-16H2,(H,23,25) |
| InChIKey | WOKKHCFCCFKOPA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |