C21H27NO5S2 — CID 57230853
[4-(3-piperidin-1-ylpropylsulfonyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 57230853) has the molecular formula C21H27NO5S2 and a molecular weight of 437.58 g/mol. Its IUPAC name is [4-(3-piperidin-1-ylpropylsulfonyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(3-piperidin-1-ylpropylsulfonyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57230853 |
| Molecular Formula | C21H27NO5S2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [4-(3-piperidin-1-ylpropylsulfonyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(S(=O)(=O)CCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H27NO5S2/c1-18-6-10-21(11-7-18)29(25,26)27-19-8-12-20(13-9-19)28(23,24)17-5-16-22-14-3-2-4-15-22/h6-13H,2-5,14-17H2,1H3 |
| InChIKey | OQMIIVKRBVSMDS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|