C33H40N2O5S — CID 86592782
[4-[[N-(cyclohexanecarbonyl)-4-(2-pyrrolidin-1-ylethoxy)anilino]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 86592782) has the molecular formula C33H40N2O5S and a molecular weight of 576.76 g/mol. Its IUPAC name is [4-[[N-(cyclohexanecarbonyl)-4-(2-pyrrolidin-1-ylethoxy)anilino]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[N-(cyclohexanecarbonyl)-4-(2-pyrrolidin-1-ylethoxy)anilino]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86592782 |
| Molecular Formula | C33H40N2O5S |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | [4-[[N-(cyclohexanecarbonyl)-4-(2-pyrrolidin-1-ylethoxy)anilino]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(CN(C(=O)C3CCCCC3)c3ccc(OCCN4CCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H40N2O5S/c1-26-9-19-32(20-10-26)41(37,38)40-31-15-11-27(12-16-31)25-35(33(36)28-7-3-2-4-8-28)29-13-17-30(18-14-29)39-24-23-34-21-5-6-22-34/h9-20,28H,2-8,21-25H2,1H3 |
| InChIKey | LZEWSRCZPZHRQK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|