C29H39N3O6S — CID 57188989
[(2S)-3-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 57188989) has the molecular formula C29H39N3O6S and a molecular weight of 557.71 g/mol. Its IUPAC name is [(2S)-3-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2S)-3-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57188989 |
| Molecular Formula | C29H39N3O6S |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | [(2S)-3-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(OCCN3CCCCCC3)cc2)C(=O)OC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C29H39N3O6S/c1-22-8-14-25(15-9-22)39(35,36)31-27(29(34)38-28(33)26-7-6-16-30-26)21-23-10-12-24(13-11-23)37-20-19-32-17-4-2-3-5-18-32/h8-15,26-27,30-31H,2-7,16-21H2,1H3/t26-,27-/m0/s1 |
| InChIKey | NZUGCSBJCXREGW-SVBPBHIXSA-N |
| XLogP | 2.96 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|