C26H33N3O6S — CID 90824450
[(2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-(4-phenylbutylamino)butanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 90824450) has the molecular formula C26H33N3O6S and a molecular weight of 515.63 g/mol. Its IUPAC name is [(2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-(4-phenylbutylamino)butanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-(4-phenylbutylamino)butanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90824450 |
| Molecular Formula | C26H33N3O6S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | [(2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-(4-phenylbutylamino)butanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)NCCCCc2ccccc2)C(=O)OC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C26H33N3O6S/c1-19-12-14-21(15-13-19)36(33,34)29-23(26(32)35-25(31)22-11-7-17-27-22)18-24(30)28-16-6-5-10-20-8-3-2-4-9-20/h2-4,8-9,12-15,22-23,27,29H,5-7,10-11,16-18H2,1H3,(H,28,30)/t22-,23-/m0/s1 |
| InChIKey | IDNFEJCKGRLOAK-GOTSBHOMSA-N |
| XLogP | 1.99 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|