C27H34N4O6S — CID 57144952
[(2S)-2-[(4-methylphenyl)sulfonylamino]-3-[4-(piperidine-3-carbonylamino)phenyl]propanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 57144952) has the molecular formula C27H34N4O6S and a molecular weight of 542.66 g/mol. Its IUPAC name is [(2S)-2-[(4-methylphenyl)sulfonylamino]-3-[4-(piperidine-3-carbonylamino)phenyl]propanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2S)-2-[(4-methylphenyl)sulfonylamino]-3-[4-(piperidine-3-carbonylamino)phenyl]propanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57144952 |
| Molecular Formula | C27H34N4O6S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [(2S)-2-[(4-methylphenyl)sulfonylamino]-3-[4-(piperidine-3-carbonylamino)phenyl]propanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(NC(=O)C3CCCNC3)cc2)C(=O)OC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C27H34N4O6S/c1-18-6-12-22(13-7-18)38(35,36)31-24(27(34)37-26(33)23-5-3-15-29-23)16-19-8-10-21(11-9-19)30-25(32)20-4-2-14-28-17-20/h6-13,20,23-24,28-29,31H,2-5,14-17H2,1H3,(H,30,32)/t20?,23-,24-/m0/s1 |
| InChIKey | YWQDCYHKUYMHHB-BMTNDILFSA-N |
| XLogP | 1.64 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|