C22H26N4O6S — CID 90786903
[(2S)-2-[(4-methylphenyl)sulfonylamino]-5-oxo-5-(pyridin-2-ylamino)pentanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 90786903) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is [(2S)-2-[(4-methylphenyl)sulfonylamino]-5-oxo-5-(pyridin-2-ylamino)pentanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2S)-2-[(4-methylphenyl)sulfonylamino]-5-oxo-5-(pyridin-2-ylamino)pentanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90786903 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [(2S)-2-[(4-methylphenyl)sulfonylamino]-5-oxo-5-(pyridin-2-ylamino)pentanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCC(=O)Nc2ccccn2)C(=O)OC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C22H26N4O6S/c1-15-7-9-16(10-8-15)33(30,31)26-18(22(29)32-21(28)17-5-4-14-23-17)11-12-20(27)25-19-6-2-3-13-24-19/h2-3,6-10,13,17-18,23,26H,4-5,11-12,14H2,1H3,(H,24,25,27)/t17-,18-/m0/s1 |
| InChIKey | BBWLCTCGEDCSNE-ROUUACIJSA-N |
| XLogP | 1.28 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|