C21H30N2O5S — CID 91236701
[(2S)-3-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 91236701) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2S)-3-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91236701 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(2S)-3-cyclohexyl-2-[(4-methylphenyl)sulfonylamino]propanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC2CCCCC2)C(=O)OC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C21H30N2O5S/c1-15-9-11-17(12-10-15)29(26,27)23-19(14-16-6-3-2-4-7-16)21(25)28-20(24)18-8-5-13-22-18/h9-12,16,18-19,22-23H,2-8,13-14H2,1H3/t18-,19-/m0/s1 |
| InChIKey | XBLVIXIOZIWUCF-OALUTQOASA-N |
| XLogP | 2.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|