C12H17N3O3S — CID 61178611
(2S)-N-[4-(methylsulfamoyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 61178611) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is (2S)-N-[4-(methylsulfamoyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-(methylsulfamoyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 61178611 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2S)-N-[4-(methylsulfamoyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C12H17N3O3S/c1-13-19(17,18)10-6-4-9(5-7-10)15-12(16)11-3-2-8-14-11/h4-7,11,13-14H,2-3,8H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | JPYGEEBKVOBWEW-NSHDSACASA-N |
| XLogP | 0.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |