C12H14F2N2O3S — CID 104900564
(2R)-N-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 104900564) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is (2R)-N-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 104900564 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2R)-N-[4-(difluoromethylsulfonyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)F)cc1)[C@H]1CCCN1 |
| InChI | InChI=1S/C12H14F2N2O3S/c13-12(14)20(18,19)9-5-3-8(4-6-9)16-11(17)10-2-1-7-15-10/h3-6,10,12,15H,1-2,7H2,(H,16,17)/t10-/m1/s1 |
| InChIKey | LYOSISCHKMABHV-SNVBAGLBSA-N |
| XLogP | 1.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |