C18H19F2N3O3S — CID 119270164
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]piperidine-2-carboxamide (PubChem CID 119270164) has the molecular formula C18H19F2N3O3S and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]piperidine-2-carboxamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119270164 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1)C1CCCCN1 |
| InChI | InChI=1S/C18H19F2N3O3S/c19-15-9-8-14(11-16(15)20)27(25,26)23-13-6-4-12(5-7-13)22-18(24)17-3-1-2-10-21-17/h4-9,11,17,21,23H,1-3,10H2,(H,22,24) |
| InChIKey | BPGWGFQPHNITKC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |