C20H18F2N2O5S — CID 42889557
6-[[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 42889557) has the molecular formula C20H18F2N2O5S and a molecular weight of 436.44 g/mol. Its IUPAC name is 6-[[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 42889557 |
| Molecular Formula | C20H18F2N2O5S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 6-[[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H18F2N2O5S/c21-17-10-9-14(11-18(17)22)30(28,29)24-13-7-5-12(6-8-13)23-19(25)15-3-1-2-4-16(15)20(26)27/h1-2,5-11,15-16,24H,3-4H2,(H,23,25)(H,26,27) |
| InChIKey | NAGRFWWSAURIFI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|