C22H24N2O7S — CID 45312079
6-[[2-methoxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 45312079) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is 6-[[2-methoxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[2-methoxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 45312079 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 6-[[2-methoxy-5-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OC)c(NC(=O)C3CC=CCC3C(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H24N2O7S/c1-30-15-9-7-14(8-10-15)24-32(28,29)16-11-12-20(31-2)19(13-16)23-21(25)17-5-3-4-6-18(17)22(26)27/h3-4,7-13,17-18,24H,5-6H2,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | QQTSRRXGZGZYDI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|