C22H22Cl2N2O5S — CID 29055994
(1S,6S)-6-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 29055994) has the molecular formula C22H22Cl2N2O5S and a molecular weight of 497.40 g/mol. Its IUPAC name is (1S,6S)-6-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 29055994 |
| Molecular Formula | C22H22Cl2N2O5S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | (1S,6S)-6-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@H](C(=O)Nc2ccc(S(=O)(=O)Nc3cc(Cl)cc(Cl)c3)cc2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C22H22Cl2N2O5S/c1-12-7-19(20(22(28)29)8-13(12)2)21(27)25-16-3-5-18(6-4-16)32(30,31)26-17-10-14(23)9-15(24)11-17/h3-6,9-11,19-20,26H,7-8H2,1-2H3,(H,25,27)(H,28,29)/t19-,20-/m0/s1 |
| InChIKey | SXQHYQCTRYBHOT-PMACEKPBSA-N |
| XLogP | 5.18 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|