C24H24Cl2N2O5S — CID 51706397
(1R,2S,3R,4S)-3-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 51706397) has the molecular formula C24H24Cl2N2O5S and a molecular weight of 523.44 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4S)-3-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 51706397 |
| Molecular Formula | C24H24Cl2N2O5S |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | (1R,2S,3R,4S)-3-[[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@H](C(=O)O)[C@@H]2C(=O)Nc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H24Cl2N2O5S/c1-12(2)20-18-7-8-19(20)22(24(30)31)21(18)23(29)27-15-3-5-17(6-4-15)34(32,33)28-16-10-13(25)9-14(26)11-16/h3-6,9-11,18-19,21-22,28H,7-8H2,1-2H3,(H,27,29)(H,30,31)/t18-,19+,21-,22+/m1/s1 |
| InChIKey | KRTOWQRBZPPUDW-KIZRIRGWSA-N |
| XLogP | 5.43 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|