C16H17Cl2NO3 — CID 896988
(1R,6S)-6-[(3,5-dichlorophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 896988) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is (1R,6S)-6-[(3,5-dichlorophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[(3,5-dichlorophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 896988 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (1R,6S)-6-[(3,5-dichlorophenyl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@@H](C(=O)O)[C@@H](C(=O)Nc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C16H17Cl2NO3/c1-8-3-13(14(16(21)22)4-9(8)2)15(20)19-12-6-10(17)5-11(18)7-12/h5-7,13-14H,3-4H2,1-2H3,(H,19,20)(H,21,22)/t13-,14+/m0/s1 |
| InChIKey | VDBPMDLICMFYOB-UONOGXRCSA-N |
| XLogP | 4.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|