C12H13F3N2O — CID 113266184
(2S)-N-(3,4,5-trifluorophenyl)piperidine-2-carboxamide (PubChem CID 113266184) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is (2S)-N-(3,4,5-trifluorophenyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(3,4,5-trifluorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 113266184 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2S)-N-(3,4,5-trifluorophenyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C12H13F3N2O/c13-8-5-7(6-9(14)11(8)15)17-12(18)10-3-1-2-4-16-10/h5-6,10,16H,1-4H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | KMBKBYWVJUWKIP-JTQLQIEISA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|