C14H18N4O3 — CID 104913671
5-[[(2R)-piperidine-2-carbonyl]amino]benzene-1,3-dicarboxamide (PubChem CID 104913671) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-[[(2R)-piperidine-2-carbonyl]amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[[(2R)-piperidine-2-carbonyl]amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 104913671 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 5-[[(2R)-piperidine-2-carbonyl]amino]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(NC(=O)[C@H]2CCCCN2)cc(C(N)=O)c1 |
| InChI | InChI=1S/C14H18N4O3/c15-12(19)8-5-9(13(16)20)7-10(6-8)18-14(21)11-3-1-2-4-17-11/h5-7,11,17H,1-4H2,(H2,15,19)(H2,16,20)(H,18,21)/t11-/m1/s1 |
| InChIKey | KMCSWWZXNPXSET-LLVKDONJSA-N |
| XLogP | -0.04 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |