C12H14F2N2O3S2 — CID 82906170
N-[4-(difluoromethylsulfonyl)phenyl]thiomorpholine-3-carboxamide (PubChem CID 82906170) has the molecular formula C12H14F2N2O3S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82906170 |
| Molecular Formula | C12H14F2N2O3S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]thiomorpholine-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)F)cc1)C1CSCCN1 |
| InChI | InChI=1S/C12H14F2N2O3S2/c13-12(14)21(18,19)9-3-1-8(2-4-9)16-11(17)10-7-20-6-5-15-10/h1-4,10,12,15H,5-7H2,(H,16,17) |
| InChIKey | QDBFEYFVIHNUDG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |