C13H16F2N2O3S2 — CID 119938584
N-[3-(difluoromethylsulfonyl)phenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119938584) has the molecular formula C13H16F2N2O3S2 and a molecular weight of 350.41 g/mol. Its IUPAC name is N-[3-(difluoromethylsulfonyl)phenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-(difluoromethylsulfonyl)phenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119938584 |
| Molecular Formula | C13H16F2N2O3S2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-[3-(difluoromethylsulfonyl)phenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1cccc(S(=O)(=O)C(F)F)c1 |
| InChI | InChI=1S/C13H16F2N2O3S2/c14-13(15)22(19,20)11-3-1-2-9(6-11)17-12(18)7-10-8-21-5-4-16-10/h1-3,6,10,13,16H,4-5,7-8H2,(H,17,18) |
| InChIKey | ZQYUWTDWHMUAPD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |