C17H25N3O3S2 — CID 119934970
N-(3-piperidin-1-ylsulfonylphenyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119934970) has the molecular formula C17H25N3O3S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-(3-piperidin-1-ylsulfonylphenyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(3-piperidin-1-ylsulfonylphenyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119934970 |
| Molecular Formula | C17H25N3O3S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-(3-piperidin-1-ylsulfonylphenyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C17H25N3O3S2/c21-17(12-15-13-24-10-7-18-15)19-14-5-4-6-16(11-14)25(22,23)20-8-2-1-3-9-20/h4-6,11,15,18H,1-3,7-10,12-13H2,(H,19,21) |
| InChIKey | RDNJPRDIIXCZCI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |