C13H20ClN3O3S2 — CID 119937072
N-[3-(methylsulfamoyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119937072) has the molecular formula C13H20ClN3O3S2 and a molecular weight of 365.91 g/mol. Its IUPAC name is N-[3-(methylsulfamoyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[3-(methylsulfamoyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119937072 |
| Molecular Formula | C13H20ClN3O3S2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-[3-(methylsulfamoyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1cccc(NC(=O)CC2CSCCN2)c1.Cl |
| InChI | InChI=1S/C13H19N3O3S2.ClH/c1-14-21(18,19)12-4-2-3-10(7-12)16-13(17)8-11-9-20-6-5-15-11;/h2-4,7,11,14-15H,5-6,8-9H2,1H3,(H,16,17);1H |
| InChIKey | QFSXROFDAWNCPZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |