C16H25ClN2O3S2 — CID 119939122
N-[3-(propan-2-ylsulfonylmethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119939122) has the molecular formula C16H25ClN2O3S2 and a molecular weight of 392.97 g/mol. Its IUPAC name is N-[3-(propan-2-ylsulfonylmethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[3-(propan-2-ylsulfonylmethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119939122 |
| Molecular Formula | C16H25ClN2O3S2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[3-(propan-2-ylsulfonylmethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CC(C)S(=O)(=O)Cc1cccc(NC(=O)CC2CSCCN2)c1.Cl |
| InChI | InChI=1S/C16H24N2O3S2.ClH/c1-12(2)23(20,21)11-13-4-3-5-14(8-13)18-16(19)9-15-10-22-7-6-17-15;/h3-5,8,12,15,17H,6-7,9-11H2,1-2H3,(H,18,19);1H |
| InChIKey | CAFOXDNNGKGYCK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |