C20H25NO5S — CID 88501986
benzyl piperidine-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 88501986) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is benzyl piperidine-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | benzyl piperidine-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88501986 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | benzyl piperidine-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C(OCc1ccccc1)C1CCCCN1 |
| InChI | InChI=1S/C13H17NO2.C7H8O3S/c15-13(12-8-4-5-9-14-12)16-10-11-6-2-1-3-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h1-3,6-7,12,14H,4-5,8-10H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | YQJKFQJFGDAGIN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|