C19H21N3O5S — CID 54062276
benzyl N-[(2S)-pyrrolidine-2-carbonyl]-N-(4-sulfamoylphenyl)carbamate (PubChem CID 54062276) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is benzyl N-[(2S)-pyrrolidine-2-carbonyl]-N-(4-sulfamoylphenyl)carbamate.
| Compound Name | benzyl N-[(2S)-pyrrolidine-2-carbonyl]-N-(4-sulfamoylphenyl)carbamate |
|---|---|
| PubChem CID | 54062276 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | benzyl N-[(2S)-pyrrolidine-2-carbonyl]-N-(4-sulfamoylphenyl)carbamate |
| SMILES | NS(=O)(=O)c1ccc(N(C(=O)OCc2ccccc2)C(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C19H21N3O5S/c20-28(25,26)16-10-8-15(9-11-16)22(18(23)17-7-4-12-21-17)19(24)27-13-14-5-2-1-3-6-14/h1-3,5-6,8-11,17,21H,4,7,12-13H2,(H2,20,25,26)/t17-/m0/s1 |
| InChIKey | MAOINMKLHBZENJ-KRWDZBQOSA-N |
| XLogP | 1.76 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |