C15H18N2O5 — CID 54088548
benzyl N-(2-hydroxyacetyl)-N-[(2S)-pyrrolidine-2-carbonyl]carbamate (PubChem CID 54088548) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is benzyl N-(2-hydroxyacetyl)-N-[(2S)-pyrrolidine-2-carbonyl]carbamate.
| Compound Name | benzyl N-(2-hydroxyacetyl)-N-[(2S)-pyrrolidine-2-carbonyl]carbamate |
|---|---|
| PubChem CID | 54088548 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | benzyl N-(2-hydroxyacetyl)-N-[(2S)-pyrrolidine-2-carbonyl]carbamate |
| SMILES | O=C(CO)N(C(=O)OCc1ccccc1)C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C15H18N2O5/c18-9-13(19)17(14(20)12-7-4-8-16-12)15(21)22-10-11-5-2-1-3-6-11/h1-3,5-6,12,16,18H,4,7-10H2/t12-/m0/s1 |
| InChIKey | MSFJWSJXJGCJLY-LBPRGKRZSA-N |
| XLogP | 0.42 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |