C21H30N4O6 — CID 70492813
2-[[6-amino-2-[phenylmethoxycarbonyl(pyrrolidine-2-carbonyl)amino]hexanoyl]amino]acetic acid (PubChem CID 70492813) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[[6-amino-2-[phenylmethoxycarbonyl(pyrrolidine-2-carbonyl)amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[phenylmethoxycarbonyl(pyrrolidine-2-carbonyl)amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 70492813 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-[[6-amino-2-[phenylmethoxycarbonyl(pyrrolidine-2-carbonyl)amino]hexanoyl]amino]acetic acid |
| SMILES | NCCCCC(C(=O)NCC(=O)O)N(C(=O)OCc1ccccc1)C(=O)C1CCCN1 |
| InChI | InChI=1S/C21H30N4O6/c22-11-5-4-10-17(19(28)24-13-18(26)27)25(20(29)16-9-6-12-23-16)21(30)31-14-15-7-2-1-3-8-15/h1-3,7-8,16-17,23H,4-6,9-14,22H2,(H,24,28)(H,26,27) |
| InChIKey | DKLIRFNNGTWTLY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|