C29H38N4O7 — CID 123849952
benzyl 4-[[(2S)-2-[(2-acetamidoacetyl)-phenylmethoxycarbonylamino]-6-aminohexanoyl]amino]butanoate (PubChem CID 123849952) has the molecular formula C29H38N4O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is benzyl 4-[[(2S)-2-[(2-acetamidoacetyl)-phenylmethoxycarbonylamino]-6-aminohexanoyl]amino]butanoate.
| Compound Name | benzyl 4-[[(2S)-2-[(2-acetamidoacetyl)-phenylmethoxycarbonylamino]-6-aminohexanoyl]amino]butanoate |
|---|---|
| PubChem CID | 123849952 |
| Molecular Formula | C29H38N4O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | benzyl 4-[[(2S)-2-[(2-acetamidoacetyl)-phenylmethoxycarbonylamino]-6-aminohexanoyl]amino]butanoate |
| SMILES | CC(=O)NCC(=O)N(C(=O)OCc1ccccc1)[C@@H](CCCCN)C(=O)NCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H38N4O7/c1-22(34)32-19-26(35)33(29(38)40-21-24-13-6-3-7-14-24)25(15-8-9-17-30)28(37)31-18-10-16-27(36)39-20-23-11-4-2-5-12-23/h2-7,11-14,25H,8-10,15-21,30H2,1H3,(H,31,37)(H,32,34)/t25-/m0/s1 |
| InChIKey | AIXPVVKGEKOHBE-VWLOTQADSA-N |
| XLogP | 2.43 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|