C22H37N5O4 — CID 166550130
benzyl 6-[[(2S)-2-amino-5-[bis(2-aminoethyl)amino]-5-oxopentanoyl]amino]hexanoate (PubChem CID 166550130) has the molecular formula C22H37N5O4 and a molecular weight of 435.57 g/mol. Its IUPAC name is benzyl 6-[[(2S)-2-amino-5-[bis(2-aminoethyl)amino]-5-oxopentanoyl]amino]hexanoate.
| Compound Name | benzyl 6-[[(2S)-2-amino-5-[bis(2-aminoethyl)amino]-5-oxopentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 166550130 |
| Molecular Formula | C22H37N5O4 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | benzyl 6-[[(2S)-2-amino-5-[bis(2-aminoethyl)amino]-5-oxopentanoyl]amino]hexanoate |
| SMILES | NCCN(CCN)C(=O)CC[C@H](N)C(=O)NCCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H37N5O4/c23-12-15-27(16-13-24)20(28)11-10-19(25)22(30)26-14-6-2-5-9-21(29)31-17-18-7-3-1-4-8-18/h1,3-4,7-8,19H,2,5-6,9-17,23-25H2,(H,26,30)/t19-/m0/s1 |
| InChIKey | UINMYGXXJLNWLZ-IBGZPJMESA-N |
| XLogP | 0.26 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|