C40H42N4O11 — CID 99658351
5-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-[[(2R)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]pentanedioate (PubChem CID 99658351) has the molecular formula C40H42N4O11 and a molecular weight of 754.79 g/mol. Its IUPAC name is 5-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-[[(2R)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]pentanedioate.
| Compound Name | 5-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-[[(2R)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 99658351 |
| Molecular Formula | C40H42N4O11 |
| Molecular Weight | 754.79 g/mol |
| Exact Mass | 754.29 |
| IUPAC Name | 5-O-benzyl 1-O-(4-nitrophenyl) (2R)-2-[[(2R)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]pentanedioate |
| SMILES | NCCCC[C@H](C(=O)N[C@H](CCC(=O)OCc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H42N4O11/c41-25-11-10-18-35(43(39(48)53-27-30-14-6-2-7-15-30)40(49)54-28-31-16-8-3-9-17-31)37(46)42-34(23-24-36(45)52-26-29-12-4-1-5-13-29)38(47)55-33-21-19-32(20-22-33)44(50)51/h1-9,12-17,19-22,34-35H,10-11,18,23-28,41H2,(H,42,46)/t34-,35-/m1/s1 |
| InChIKey | BCEKQYFMCZRDDW-VSJLXWSYSA-N |
| XLogP | 5.98 |
| TPSA | 206.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.79 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|