C30H38N4O11 — CID 142727531
[(2S)-6-amino-1-[(2S)-6-amino-2-[carboxy(phenylmethoxycarbonyl)amino]hexanoyl]oxy-1-oxohexan-2-yl]-phenylmethoxycarbonylcarbamic acid (PubChem CID 142727531) has the molecular formula C30H38N4O11 and a molecular weight of 630.65 g/mol. Its IUPAC name is [(2S)-6-amino-1-[(2S)-6-amino-2-[carboxy(phenylmethoxycarbonyl)amino]hexanoyl]oxy-1-oxohexan-2-yl]-phenylmethoxycarbonylcarbamic acid.
| Compound Name | [(2S)-6-amino-1-[(2S)-6-amino-2-[carboxy(phenylmethoxycarbonyl)amino]hexanoyl]oxy-1-oxohexan-2-yl]-phenylmethoxycarbonylcarbamic acid |
|---|---|
| PubChem CID | 142727531 |
| Molecular Formula | C30H38N4O11 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | [(2S)-6-amino-1-[(2S)-6-amino-2-[carboxy(phenylmethoxycarbonyl)amino]hexanoyl]oxy-1-oxohexan-2-yl]-phenylmethoxycarbonylcarbamic acid |
| SMILES | NCCCC[C@@H](C(=O)OC(=O)[C@H](CCCCN)N(C(=O)O)C(=O)OCc1ccccc1)N(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H38N4O11/c31-17-9-7-15-23(33(27(37)38)29(41)43-19-21-11-3-1-4-12-21)25(35)45-26(36)24(16-8-10-18-32)34(28(39)40)30(42)44-20-22-13-5-2-6-14-22/h1-6,11-14,23-24H,7-10,15-20,31-32H2,(H,37,38)(H,39,40)/t23-,24-/m0/s1 |
| InChIKey | YDIIUOOAWTZHJV-ZEQRLZLVSA-N |
| XLogP | 3.68 |
| TPSA | 229.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|