C27H33N3O9 — CID 22828227
(2S,4R,5R)-5-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-hydroxyoxolane-2-carboxylic acid (PubChem CID 22828227) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is (2S,4R,5R)-5-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-hydroxyoxolane-2-carboxylic acid.
| Compound Name | (2S,4R,5R)-5-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-hydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 22828227 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | (2S,4R,5R)-5-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-hydroxyoxolane-2-carboxylic acid |
| SMILES | NCCCC[C@@H](C(=O)N[C@@H]1O[C@H](C(=O)O)C[C@H]1O)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H33N3O9/c28-14-8-7-13-20(23(32)29-24-21(31)15-22(39-24)25(33)34)30(26(35)37-16-18-9-3-1-4-10-18)27(36)38-17-19-11-5-2-6-12-19/h1-6,9-12,20-22,24,31H,7-8,13-17,28H2,(H,29,32)(H,33,34)/t20-,21+,22-,24+/m0/s1 |
| InChIKey | KAMDEIKVCLWRTJ-HYVLGVRCSA-N |
| XLogP | 2.14 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|