C29H42N8O5 — CID 88596469
benzyl N-[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate (PubChem CID 88596469) has the molecular formula C29H42N8O5 and a molecular weight of 582.71 g/mol. Its IUPAC name is benzyl N-[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 88596469 |
| Molecular Formula | C29H42N8O5 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | benzyl N-[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate |
| SMILES | NCCCC[C@@H](C(N)=O)N(C(=O)OCc1ccccc1)C(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C29H42N8O5/c30-16-8-7-15-24(25(32)38)37(29(41)42-19-21-12-5-2-6-13-21)27(40)23(18-20-10-3-1-4-11-20)36-26(39)22(31)14-9-17-35-28(33)34/h1-6,10-13,22-24H,7-9,14-19,30-31H2,(H2,32,38)(H,36,39)(H4,33,34,35)/t22-,23+,24+/m1/s1 |
| InChIKey | RJJMJXXKGYASEL-SGNDLWITSA-N |
| XLogP | 0.24 |
| TPSA | 235.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|