C31H37N2O5P — CID 122228751
methyl (2S)-6-amino-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]-phenylmethoxycarbonylamino]hexanoate (PubChem CID 122228751) has the molecular formula C31H37N2O5P and a molecular weight of 548.62 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]-phenylmethoxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]-phenylmethoxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 122228751 |
| Molecular Formula | C31H37N2O5P |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | methyl (2S)-6-amino-2-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]-phenylmethoxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCN)N(C(=O)OCc1ccccc1)P1(=O)[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H37N2O5P/c1-37-30(34)27(19-11-12-22-32)33(31(35)38-23-24-13-5-2-6-14-24)39(36)28(25-15-7-3-8-16-25)20-21-29(39)26-17-9-4-10-18-26/h2-10,13-18,27-29H,11-12,19-23,32H2,1H3/t27-,28-,29-/m0/s1 |
| InChIKey | LLMLKZFXKVACGN-AWCRTANDSA-N |
| XLogP | 6.85 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|