C14H19NO5 — CID 10731503
methyl (2S)-2-[methoxy(phenylmethoxycarbonyl)amino]butanoate (PubChem CID 10731503) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl (2S)-2-[methoxy(phenylmethoxycarbonyl)amino]butanoate.
| Compound Name | methyl (2S)-2-[methoxy(phenylmethoxycarbonyl)amino]butanoate |
|---|---|
| PubChem CID | 10731503 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | methyl (2S)-2-[methoxy(phenylmethoxycarbonyl)amino]butanoate |
| SMILES | CC[C@@H](C(=O)OC)N(OC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO5/c1-4-12(13(16)18-2)15(19-3)14(17)20-10-11-8-6-5-7-9-11/h5-9,12H,4,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | MKSNDGSGYKEKAC-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|